C11H29N3O2S — CID 70200253
N-ethylethanamine;methanesulfonamide;3-methylpiperidine (PubChem CID 70200253) has the molecular formula C11H29N3O2S and a molecular weight of 267.44 g/mol. Its IUPAC name is N-ethylethanamine;methanesulfonamide;3-methylpiperidine.
| Compound Name | N-ethylethanamine;methanesulfonamide;3-methylpiperidine |
|---|---|
| PubChem CID | 70200253 |
| Molecular Formula | C11H29N3O2S |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | N-ethylethanamine;methanesulfonamide;3-methylpiperidine |
| SMILES | CC1CCCNC1.CCNCC.CS(N)(=O)=O |
| InChI | InChI=1S/C6H13N.C4H11N.CH5NO2S/c1-6-3-2-4-7-5-6;1-3-5-4-2;1-5(2,3)4/h6-7H,2-5H2,1H3;5H,3-4H2,1-2H3;1H3,(H2,2,3,4) |
| InChIKey | JRIMAHIGKYNWQP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |