C20H25Cl2F3N2OS — CID 70200344
(2R,3R)-3-[[2-methoxy-5-(trifluoromethylsulfanyl)phenyl]methyl]-2-phenylpiperidin-1-amine;dihydrochloride (PubChem CID 70200344) has the molecular formula C20H25Cl2F3N2OS and a molecular weight of 469.40 g/mol. Its IUPAC name is (2R,3R)-3-[[2-methoxy-5-(trifluoromethylsulfanyl)phenyl]methyl]-2-phenylpiperidin-1-amine;dihydrochloride.
| Compound Name | (2R,3R)-3-[[2-methoxy-5-(trifluoromethylsulfanyl)phenyl]methyl]-2-phenylpiperidin-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 70200344 |
| Molecular Formula | C20H25Cl2F3N2OS |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | (2R,3R)-3-[[2-methoxy-5-(trifluoromethylsulfanyl)phenyl]methyl]-2-phenylpiperidin-1-amine;dihydrochloride |
| SMILES | COc1ccc(SC(F)(F)F)cc1C[C@H]1CCCN(N)[C@H]1c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C20H23F3N2OS.2ClH/c1-26-18-10-9-17(27-20(21,22)23)13-16(18)12-15-8-5-11-25(24)19(15)14-6-3-2-4-7-14;;/h2-4,6-7,9-10,13,15,19H,5,8,11-12,24H2,1H3;2*1H/t15-,19+;;/m1../s1 |
| InChIKey | IIPWWJRYWJVYQD-HOOCCGKBSA-N |
| XLogP | 6.02 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|