C30H34N2O — CID 70200360
(4-methylphenyl)-[3-phenyl-4-[(4-phenylpiperidin-1-yl)methyl]pyrrolidin-1-yl]methanone (PubChem CID 70200360) has the molecular formula C30H34N2O and a molecular weight of 438.62 g/mol. Its IUPAC name is (4-methylphenyl)-[3-phenyl-4-[(4-phenylpiperidin-1-yl)methyl]pyrrolidin-1-yl]methanone.
| Compound Name | (4-methylphenyl)-[3-phenyl-4-[(4-phenylpiperidin-1-yl)methyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 70200360 |
| Molecular Formula | C30H34N2O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | (4-methylphenyl)-[3-phenyl-4-[(4-phenylpiperidin-1-yl)methyl]pyrrolidin-1-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CC(CN3CCC(c4ccccc4)CC3)C(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C30H34N2O/c1-23-12-14-27(15-13-23)30(33)32-21-28(29(22-32)26-10-6-3-7-11-26)20-31-18-16-25(17-19-31)24-8-4-2-5-9-24/h2-15,25,28-29H,16-22H2,1H3 |
| InChIKey | DVHULDDCWVBRPK-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |