C18H31N5O6 — CID 70200519
[(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(dibutylcarbamoyl)-3,4-dihydro-2H-pyran-6-yl] hydrogen carbonate (PubChem CID 70200519) has the molecular formula C18H31N5O6 and a molecular weight of 413.48 g/mol. Its IUPAC name is [(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(dibutylcarbamoyl)-3,4-dihydro-2H-pyran-6-yl] hydrogen carbonate.
| Compound Name | [(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(dibutylcarbamoyl)-3,4-dihydro-2H-pyran-6-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70200519 |
| Molecular Formula | C18H31N5O6 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | [(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(dibutylcarbamoyl)-3,4-dihydro-2H-pyran-6-yl] hydrogen carbonate |
| SMILES | CCCCN(CCCC)C(=O)[C@@H]1OC(OC(=O)O)=C[C@H](N=C(N)N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C18H31N5O6/c1-4-6-8-23(9-7-5-2)16(25)15-14(21-11(3)24)12(22-17(19)20)10-13(28-15)29-18(26)27/h10,12,14-15H,4-9H2,1-3H3,(H,21,24)(H,26,27)(H4,19,20,22)/t12-,14+,15+/m0/s1 |
| InChIKey | OJWFLTRKFXYOKI-NWANDNLSSA-N |
| XLogP | 0.50 |
| TPSA | 169.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|