C12H19N5O6 — CID 70200589
[(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(dimethylcarbamoyl)-3,4-dihydro-2H-pyran-6-yl] hydrogen carbonate (PubChem CID 70200589) has the molecular formula C12H19N5O6 and a molecular weight of 329.31 g/mol. Its IUPAC name is [(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(dimethylcarbamoyl)-3,4-dihydro-2H-pyran-6-yl] hydrogen carbonate.
| Compound Name | [(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(dimethylcarbamoyl)-3,4-dihydro-2H-pyran-6-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70200589 |
| Molecular Formula | C12H19N5O6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | [(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(dimethylcarbamoyl)-3,4-dihydro-2H-pyran-6-yl] hydrogen carbonate |
| SMILES | CC(=O)N[C@@H]1[C@@H](N=C(N)N)C=C(OC(=O)O)O[C@H]1C(=O)N(C)C |
| InChI | InChI=1S/C12H19N5O6/c1-5(18)15-8-6(16-11(13)14)4-7(23-12(20)21)22-9(8)10(19)17(2)3/h4,6,8-9H,1-3H3,(H,15,18)(H,20,21)(H4,13,14,16)/t6-,8+,9+/m0/s1 |
| InChIKey | ITSMFXQCLRQUQD-NBEYISGCSA-N |
| XLogP | -1.84 |
| TPSA | 169.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|