C13H12N2O3 — CID 70201313
5-(2,3-dihydro-1H-inden-5-yl)-1,3-diazinane-2,4,6-trione (PubChem CID 70201313) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 5-(2,3-dihydro-1H-inden-5-yl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2,3-dihydro-1H-inden-5-yl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 70201313 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-(2,3-dihydro-1H-inden-5-yl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(c2ccc3c(c2)CCC3)C(=O)N1 |
| InChI | InChI=1S/C13H12N2O3/c16-11-10(12(17)15-13(18)14-11)9-5-4-7-2-1-3-8(7)6-9/h4-6,10H,1-3H2,(H2,14,15,16,17,18) |
| InChIKey | BTXOOUGMSOOQLR-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|