About 1-phenylethanamine;3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid
1-phenylethanamine;3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid (PubChem CID 70201572) has the molecular formula C12H16F3NO3
and a molecular weight of 279.26 g/mol. Its IUPAC name is 1-phenylethanamine;3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 1-phenylethanamine;3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid |
| PubChem CID | 70201572 |
| Molecular Formula | C12H16F3NO3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-phenylethanamine;3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(N)c1ccccc1.CC(O)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C8H11N.C4H5F3O3/c1-7(9)8-5-3-2-4-6-8;1-3(10,2(8)9)4(5,6)7/h2-7H,9H2,1H3;10H,1H3,(H,8,9) |
| InChIKey | LGWBCCHKQSSTGZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenylethanamine;3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethanamine;3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid?
The IUPAC name of 1-phenylethanamine;3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid (CID 70201572) is 1-phenylethanamine;3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid.
What is the SMILES notation for 1-phenylethanamine;3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid?
The canonical SMILES for 1-phenylethanamine;3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid is CC(N)c1ccccc1.CC(O)(C(=O)O)C(F)(F)F.
What is the InChIKey of 1-phenylethanamine;3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid?
The InChIKey is LGWBCCHKQSSTGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C4H5F3O3/c1-7(9)8-5-3-2-4-6-8;1-3(10,2(8)9)4(5,6)7/h2-7H,9H2,1H3;10H,1H3,(H,8,9).
What are the key properties of 1-phenylethanamine;3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid?
1-phenylethanamine;3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid has a molecular weight of 279.26 g/mol, XLogP of 2.09, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethanamine;3,3,3-trifluoro-2-hydroxy-2-methylpropanoic acid is sourced from PubChem (CID 70201572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).