C16H12F3NO3S2 — CID 70201964
3,3,3-trifluoro-2-hydroxy-2-methyl-N-(4-oxo-10H-thieno[2,3-c][1]benzothiepin-7-yl)propanamide (PubChem CID 70201964) has the molecular formula C16H12F3NO3S2 and a molecular weight of 387.40 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-hydroxy-2-methyl-N-(4-oxo-10H-thieno[2,3-c][1]benzothiepin-7-yl)propanamide.
| Compound Name | 3,3,3-trifluoro-2-hydroxy-2-methyl-N-(4-oxo-10H-thieno[2,3-c][1]benzothiepin-7-yl)propanamide |
|---|---|
| PubChem CID | 70201964 |
| Molecular Formula | C16H12F3NO3S2 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 3,3,3-trifluoro-2-hydroxy-2-methyl-N-(4-oxo-10H-thieno[2,3-c][1]benzothiepin-7-yl)propanamide |
| SMILES | CC(O)(C(=O)Nc1ccc2c(c1)SC(=O)c1sccc1C2)C(F)(F)F |
| InChI | InChI=1S/C16H12F3NO3S2/c1-15(23,16(17,18)19)14(22)20-10-3-2-8-6-9-4-5-24-12(9)13(21)25-11(8)7-10/h2-5,7,23H,6H2,1H3,(H,20,22) |
| InChIKey | NSEIOTGBRFJKST-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|