About 2-[4-(6,7-dihydro-3H-inden-1-yl)phenoxy]-5-(trifluoromethyl)pyridine
2-[4-(6,7-dihydro-3H-inden-1-yl)phenoxy]-5-(trifluoromethyl)pyridine (PubChem CID 70202217) has the molecular formula C21H16F3NO
and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-[4-(6,7-dihydro-3H-inden-1-yl)phenoxy]-5-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 2-[4-(6,7-dihydro-3H-inden-1-yl)phenoxy]-5-(trifluoromethyl)pyridine |
| PubChem CID | 70202217 |
| Molecular Formula | C21H16F3NO |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-[4-(6,7-dihydro-3H-inden-1-yl)phenoxy]-5-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccc(Oc2ccc(C3=CCC4=C3CCC=C4)cc2)nc1 |
| InChI | InChI=1S/C21H16F3NO/c22-21(23,24)16-8-12-20(25-13-16)26-17-9-5-15(6-10-17)19-11-7-14-3-1-2-4-18(14)19/h1,3,5-6,8-13H,2,4,7H2 |
| InChIKey | LGSQMFNKHJCRQK-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-(6,7-dihydro-3H-inden-1-yl)phenoxy]-5-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(6,7-dihydro-3H-inden-1-yl)phenoxy]-5-(trifluoromethyl)pyridine?
The IUPAC name of 2-[4-(6,7-dihydro-3H-inden-1-yl)phenoxy]-5-(trifluoromethyl)pyridine (CID 70202217) is 2-[4-(6,7-dihydro-3H-inden-1-yl)phenoxy]-5-(trifluoromethyl)pyridine.
What is the SMILES notation for 2-[4-(6,7-dihydro-3H-inden-1-yl)phenoxy]-5-(trifluoromethyl)pyridine?
The canonical SMILES for 2-[4-(6,7-dihydro-3H-inden-1-yl)phenoxy]-5-(trifluoromethyl)pyridine is FC(F)(F)c1ccc(Oc2ccc(C3=CCC4=C3CCC=C4)cc2)nc1.
What is the InChIKey of 2-[4-(6,7-dihydro-3H-inden-1-yl)phenoxy]-5-(trifluoromethyl)pyridine?
The InChIKey is LGSQMFNKHJCRQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F3NO/c22-21(23,24)16-8-12-20(25-13-16)26-17-9-5-15(6-10-17)19-11-7-14-3-1-2-4-18(14)19/h1,3,5-6,8-13H,2,4,7H2.
What are the key properties of 2-[4-(6,7-dihydro-3H-inden-1-yl)phenoxy]-5-(trifluoromethyl)pyridine?
2-[4-(6,7-dihydro-3H-inden-1-yl)phenoxy]-5-(trifluoromethyl)pyridine has a molecular weight of 355.36 g/mol, XLogP of 6.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(6,7-dihydro-3H-inden-1-yl)phenoxy]-5-(trifluoromethyl)pyridine is sourced from PubChem (CID 70202217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).