C16H18ClN3O3S — CID 70202595
(5Z)-5-ethylidene-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-oxazolidine-2,4-dione;hydrochloride (PubChem CID 70202595) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is (5Z)-5-ethylidene-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-oxazolidine-2,4-dione;hydrochloride.
| Compound Name | (5Z)-5-ethylidene-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-oxazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 70202595 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (5Z)-5-ethylidene-3-(4-imidazo[1,2-a]pyridin-5-ylsulfanylbutyl)-1,3-oxazolidine-2,4-dione;hydrochloride |
| SMILES | C/C=C1\OC(=O)N(CCCCSc2cccc3nccn23)C1=O.Cl |
| InChI | InChI=1S/C16H17N3O3S.ClH/c1-2-12-15(20)19(16(21)22-12)9-3-4-11-23-14-7-5-6-13-17-8-10-18(13)14;/h2,5-8,10H,3-4,9,11H2,1H3;1H/b12-2-; |
| InChIKey | WNWUBNWJTXVHOQ-QPBZENRTSA-N |
| XLogP | 3.51 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|