C15H21N5O2 — CID 70202660
1-[1-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-2,5-dione (PubChem CID 70202660) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 1-[1-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[1-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 70202660 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 1-[1-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-2,5-dione |
| SMILES | CCC(N1CCN(c2ncccn2)CC1)N1C(=O)CCC1=O |
| InChI | InChI=1S/C15H21N5O2/c1-2-12(20-13(21)4-5-14(20)22)18-8-10-19(11-9-18)15-16-6-3-7-17-15/h3,6-7,12H,2,4-5,8-11H2,1H3 |
| InChIKey | HVSCLVUBDVABOT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|