3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid

C11H17NO3 — CID 70202669

IUPAC3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid
SMILESCCCCCc1ncoc1CCC(=O)O
InChIInChI=1S/C11H17NO3/c1-2-3-4-5-9-10(15-8-12-9)6-7-11(13)14/h8H,2-7H2,1H3,(H,13,14)
InChIKeyOLKJTNLSMVPKMO-UHFFFAOYSA-N
MW211.26 g/mol
LogP2.42
Rot. Bonds7

About 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid

3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid (PubChem CID 70202669) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid.

Molecular Properties

Compound Name3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid
PubChem CID70202669
Molecular FormulaC11H17NO3
Molecular Weight211.26 g/mol
Exact Mass211.12
IUPAC Name3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid
SMILESCCCCCc1ncoc1CCC(=O)O
InChIInChI=1S/C11H17NO3/c1-2-3-4-5-9-10(15-8-12-9)6-7-11(13)14/h8H,2-7H2,1H3,(H,13,14)
InChIKeyOLKJTNLSMVPKMO-UHFFFAOYSA-N
XLogP2.42
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.26
LogP ≤ 52.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid?
The IUPAC name of 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid (CID 70202669) is 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid.
What is the SMILES notation for 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid?
The canonical SMILES for 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid is CCCCCc1ncoc1CCC(=O)O.
What is the InChIKey of 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid?
The InChIKey is OLKJTNLSMVPKMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3/c1-2-3-4-5-9-10(15-8-12-9)6-7-11(13)14/h8H,2-7H2,1H3,(H,13,14).
What are the key properties of 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid?
3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid has a molecular weight of 211.26 g/mol, XLogP of 2.42, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid is sourced from PubChem (CID 70202669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).