About 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid
3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid (PubChem CID 70202669) has the molecular formula C11H17NO3
and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid |
| PubChem CID | 70202669 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid |
| SMILES | CCCCCc1ncoc1CCC(=O)O |
| InChI | InChI=1S/C11H17NO3/c1-2-3-4-5-9-10(15-8-12-9)6-7-11(13)14/h8H,2-7H2,1H3,(H,13,14) |
| InChIKey | OLKJTNLSMVPKMO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid?
The IUPAC name of 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid (CID 70202669) is 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid.
What is the SMILES notation for 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid?
The canonical SMILES for 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid is CCCCCc1ncoc1CCC(=O)O.
What is the InChIKey of 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid?
The InChIKey is OLKJTNLSMVPKMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3/c1-2-3-4-5-9-10(15-8-12-9)6-7-11(13)14/h8H,2-7H2,1H3,(H,13,14).
What are the key properties of 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid?
3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid has a molecular weight of 211.26 g/mol, XLogP of 2.42, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-pentyl-1,3-oxazol-5-yl)propanoic acid is sourced from PubChem (CID 70202669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).