About benzyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate
benzyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate (PubChem CID 70202979) has the molecular formula C14H13ClN4O4S2
and a molecular weight of 400.87 g/mol. Its IUPAC name is benzyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate.
Molecular Properties
| Compound Name | benzyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate |
| PubChem CID | 70202979 |
| Molecular Formula | C14H13ClN4O4S2 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | benzyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate |
| SMILES | CSC(=N[N+](=O)[O-])N(Cc1cnc(Cl)s1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H13ClN4O4S2/c1-24-13(17-19(21)22)18(8-11-7-16-12(15)25-11)14(20)23-9-10-5-3-2-4-6-10/h2-7H,8-9H2,1H3 |
| InChIKey | OUIPMQLZTAVHGL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 97.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate?
The IUPAC name of benzyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate (CID 70202979) is benzyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate.
What is the SMILES notation for benzyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate?
The canonical SMILES for benzyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate is CSC(=N[N+](=O)[O-])N(Cc1cnc(Cl)s1)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate?
The InChIKey is OUIPMQLZTAVHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN4O4S2/c1-24-13(17-19(21)22)18(8-11-7-16-12(15)25-11)14(20)23-9-10-5-3-2-4-6-10/h2-7H,8-9H2,1H3.
What are the key properties of benzyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate?
benzyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate has a molecular weight of 400.87 g/mol, XLogP of 3.85, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-(C-methylsulfanyl-N-nitrocarbonimidoyl)carbamate is sourced from PubChem (CID 70202979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).