About 7,9-dihydro-3-benzazepin-8-one;hydrochloride
7,9-dihydro-3-benzazepin-8-one;hydrochloride (PubChem CID 70203172) has the molecular formula C10H10ClNO
and a molecular weight of 195.65 g/mol. Its IUPAC name is 7,9-dihydro-3-benzazepin-8-one;hydrochloride.
Molecular Properties
| Compound Name | 7,9-dihydro-3-benzazepin-8-one;hydrochloride |
| PubChem CID | 70203172 |
| Molecular Formula | C10H10ClNO |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 7,9-dihydro-3-benzazepin-8-one;hydrochloride |
| SMILES | Cl.O=C1CC=C2C=CN=CC=C2C1 |
| InChI | InChI=1S/C10H9NO.ClH/c12-10-2-1-8-3-5-11-6-4-9(8)7-10;/h1,3-6H,2,7H2;1H |
| InChIKey | CDNQECOJJSBDFH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,9-dihydro-3-benzazepin-8-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-dihydro-3-benzazepin-8-one;hydrochloride?
The IUPAC name of 7,9-dihydro-3-benzazepin-8-one;hydrochloride (CID 70203172) is 7,9-dihydro-3-benzazepin-8-one;hydrochloride.
What is the SMILES notation for 7,9-dihydro-3-benzazepin-8-one;hydrochloride?
The canonical SMILES for 7,9-dihydro-3-benzazepin-8-one;hydrochloride is Cl.O=C1CC=C2C=CN=CC=C2C1.
What is the InChIKey of 7,9-dihydro-3-benzazepin-8-one;hydrochloride?
The InChIKey is CDNQECOJJSBDFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO.ClH/c12-10-2-1-8-3-5-11-6-4-9(8)7-10;/h1,3-6H,2,7H2;1H.
What are the key properties of 7,9-dihydro-3-benzazepin-8-one;hydrochloride?
7,9-dihydro-3-benzazepin-8-one;hydrochloride has a molecular weight of 195.65 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-dihydro-3-benzazepin-8-one;hydrochloride is sourced from PubChem (CID 70203172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).