About (2S,3S)-2-aminobutane-1,3-diol
(2S,3S)-2-aminobutane-1,3-diol (PubChem CID 7020320) has the molecular formula C4H11NO2
and a molecular weight of 105.14 g/mol. Its IUPAC name is (2S,3S)-2-aminobutane-1,3-diol.
Molecular Properties
| Compound Name | (2S,3S)-2-aminobutane-1,3-diol |
| PubChem CID | 7020320 |
| Molecular Formula | C4H11NO2 |
| Molecular Weight | 105.14 g/mol |
| Exact Mass | 105.08 |
| IUPAC Name | (2S,3S)-2-aminobutane-1,3-diol |
| SMILES | C[C@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C4H11NO2/c1-3(7)4(5)2-6/h3-4,6-7H,2,5H2,1H3/t3-,4-/m0/s1 |
| InChIKey | MUVQIIBPDFTEKM-IMJSIDKUSA-N |
| XLogP | -1.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.14 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3S)-2-aminobutane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-aminobutane-1,3-diol?
The IUPAC name of (2S,3S)-2-aminobutane-1,3-diol (CID 7020320) is (2S,3S)-2-aminobutane-1,3-diol.
What is the SMILES notation for (2S,3S)-2-aminobutane-1,3-diol?
The canonical SMILES for (2S,3S)-2-aminobutane-1,3-diol is C[C@H](O)[C@@H](N)CO.
What is the InChIKey of (2S,3S)-2-aminobutane-1,3-diol?
The InChIKey is MUVQIIBPDFTEKM-IMJSIDKUSA-N. The full InChI is InChI=1S/C4H11NO2/c1-3(7)4(5)2-6/h3-4,6-7H,2,5H2,1H3/t3-,4-/m0/s1.
What are the key properties of (2S,3S)-2-aminobutane-1,3-diol?
(2S,3S)-2-aminobutane-1,3-diol has a molecular weight of 105.14 g/mol, XLogP of -1.31, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-aminobutane-1,3-diol is sourced from PubChem (CID 7020320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).