2-aminopyrimidine-5-carboxylic acid

C5H5N3O2 — CID 7020367

IUPAC2-aminopyrimidine-5-carboxylic acid
SMILESNc1ncc(C(=O)O)cn1
InChIInChI=1S/C5H5N3O2/c6-5-7-1-3(2-8-5)4(9)10/h1-2H,(H,9,10)(H2,6,7,8)
InChIKeyCBRLWSXYXSFYSP-UHFFFAOYSA-N
MW139.11 g/mol
LogP-0.24
Rot. Bonds1

About 2-aminopyrimidine-5-carboxylic acid

2-aminopyrimidine-5-carboxylic acid (PubChem CID 7020367) has the molecular formula C5H5N3O2 and a molecular weight of 139.11 g/mol. Its IUPAC name is 2-aminopyrimidine-5-carboxylic acid.

Molecular Properties

Compound Name2-aminopyrimidine-5-carboxylic acid
PubChem CID7020367
Molecular FormulaC5H5N3O2
Molecular Weight139.11 g/mol
Exact Mass139.04
IUPAC Name2-aminopyrimidine-5-carboxylic acid
SMILESNc1ncc(C(=O)O)cn1
InChIInChI=1S/C5H5N3O2/c6-5-7-1-3(2-8-5)4(9)10/h1-2H,(H,9,10)(H2,6,7,8)
InChIKeyCBRLWSXYXSFYSP-UHFFFAOYSA-N
XLogP-0.24
TPSA89.10 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500139.11
LogP ≤ 5-0.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-aminopyrimidine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminopyrimidine-5-carboxylic acid?
The IUPAC name of 2-aminopyrimidine-5-carboxylic acid (CID 7020367) is 2-aminopyrimidine-5-carboxylic acid.
What is the SMILES notation for 2-aminopyrimidine-5-carboxylic acid?
The canonical SMILES for 2-aminopyrimidine-5-carboxylic acid is Nc1ncc(C(=O)O)cn1.
What is the InChIKey of 2-aminopyrimidine-5-carboxylic acid?
The InChIKey is CBRLWSXYXSFYSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O2/c6-5-7-1-3(2-8-5)4(9)10/h1-2H,(H,9,10)(H2,6,7,8).
What are the key properties of 2-aminopyrimidine-5-carboxylic acid?
2-aminopyrimidine-5-carboxylic acid has a molecular weight of 139.11 g/mol, XLogP of -0.24, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopyrimidine-5-carboxylic acid is sourced from PubChem (CID 7020367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).