About 4-[[4-[2-[6-(hydroxymethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione
4-[[4-[2-[6-(hydroxymethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione (PubChem CID 70203832) has the molecular formula C18H18N2O4S
and a molecular weight of 358.42 g/mol. Its IUPAC name is 4-[[4-[2-[6-(hydroxymethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione.
Molecular Properties
| Compound Name | 4-[[4-[2-[6-(hydroxymethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione |
| PubChem CID | 70203832 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4-[[4-[2-[6-(hydroxymethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione |
| SMILES | O=C1NC(Cc2ccc(OCCc3cccc(CO)n3)cc2)C(=O)S1 |
| InChI | InChI=1S/C18H18N2O4S/c21-11-14-3-1-2-13(19-14)8-9-24-15-6-4-12(5-7-15)10-16-17(22)25-18(23)20-16/h1-7,16,21H,8-11H2,(H,20,23) |
| InChIKey | VNYVUVJVHHYQDE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-[2-[6-(hydroxymethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-[2-[6-(hydroxymethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione?
The IUPAC name of 4-[[4-[2-[6-(hydroxymethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione (CID 70203832) is 4-[[4-[2-[6-(hydroxymethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione.
What is the SMILES notation for 4-[[4-[2-[6-(hydroxymethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione?
The canonical SMILES for 4-[[4-[2-[6-(hydroxymethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione is O=C1NC(Cc2ccc(OCCc3cccc(CO)n3)cc2)C(=O)S1.
What is the InChIKey of 4-[[4-[2-[6-(hydroxymethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione?
The InChIKey is VNYVUVJVHHYQDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O4S/c21-11-14-3-1-2-13(19-14)8-9-24-15-6-4-12(5-7-15)10-16-17(22)25-18(23)20-16/h1-7,16,21H,8-11H2,(H,20,23).
What are the key properties of 4-[[4-[2-[6-(hydroxymethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione?
4-[[4-[2-[6-(hydroxymethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione has a molecular weight of 358.42 g/mol, XLogP of 2.09, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-[2-[6-(hydroxymethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione is sourced from PubChem (CID 70203832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).