C18H9ClF3N3O — CID 7020408
5-naphthalen-1-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carbonyl chloride (PubChem CID 7020408) has the molecular formula C18H9ClF3N3O and a molecular weight of 375.74 g/mol. Its IUPAC name is 5-naphthalen-1-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carbonyl chloride.
| Compound Name | 5-naphthalen-1-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carbonyl chloride |
|---|---|
| PubChem CID | 7020408 |
| Molecular Formula | C18H9ClF3N3O |
| Molecular Weight | 375.74 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 5-naphthalen-1-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carbonyl chloride |
| SMILES | O=C(Cl)c1cnn2c(C(F)(F)F)cc(-c3cccc4ccccc34)nc12 |
| InChI | InChI=1S/C18H9ClF3N3O/c19-16(26)13-9-23-25-15(18(20,21)22)8-14(24-17(13)25)12-7-3-5-10-4-1-2-6-11(10)12/h1-9H |
| InChIKey | KZUGOAZNENCWQC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.74 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|