C28H31N5O4 — CID 70204407
1-[1-[3-[(4-cyanophenyl)methyl]-2-methylimidazol-4-yl]propyl]-4-[(3-nitrophenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 70204407) has the molecular formula C28H31N5O4 and a molecular weight of 501.59 g/mol. Its IUPAC name is 1-[1-[3-[(4-cyanophenyl)methyl]-2-methylimidazol-4-yl]propyl]-4-[(3-nitrophenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[1-[3-[(4-cyanophenyl)methyl]-2-methylimidazol-4-yl]propyl]-4-[(3-nitrophenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 70204407 |
| Molecular Formula | C28H31N5O4 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 1-[1-[3-[(4-cyanophenyl)methyl]-2-methylimidazol-4-yl]propyl]-4-[(3-nitrophenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | CCC(c1cnc(C)n1Cc1ccc(C#N)cc1)N1CCC(Cc2cccc([N+](=O)[O-])c2)(C(=O)O)CC1 |
| InChI | InChI=1S/C28H31N5O4/c1-3-25(26-18-30-20(2)32(26)19-22-9-7-21(17-29)8-10-22)31-13-11-28(12-14-31,27(34)35)16-23-5-4-6-24(15-23)33(36)37/h4-10,15,18,25H,3,11-14,16,19H2,1-2H3,(H,34,35) |
| InChIKey | CWVSZCVJUBJKLM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|