C30H28N2O6 — CID 70204490
ethyl 5-[[5-(5-methoxy-6,13-dimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)-2,4-dioxopyrimidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 70204490) has the molecular formula C30H28N2O6 and a molecular weight of 512.56 g/mol. Its IUPAC name is ethyl 5-[[5-(5-methoxy-6,13-dimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)-2,4-dioxopyrimidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[[5-(5-methoxy-6,13-dimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)-2,4-dioxopyrimidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 70204490 |
| Molecular Formula | C30H28N2O6 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | ethyl 5-[[5-(5-methoxy-6,13-dimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)-2,4-dioxopyrimidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(Cn2cc(C3c4ccc(C)cc4C=Cc4cc(C)c(OC)cc43)c(=O)[nH]c2=O)o1 |
| InChI | InChI=1S/C30H28N2O6/c1-5-37-29(34)25-11-9-21(38-25)15-32-16-24(28(33)31-30(32)35)27-22-10-6-17(2)12-19(22)7-8-20-13-18(3)26(36-4)14-23(20)27/h6-14,16,27H,5,15H2,1-4H3,(H,31,33,35) |
| InChIKey | KEUGUUMITJNFHZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|