About N-[2-(6-amino-3,7-dihydro-2H-inden-1-yl)ethyl]acetamide
N-[2-(6-amino-3,7-dihydro-2H-inden-1-yl)ethyl]acetamide (PubChem CID 70204797) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is N-[2-(6-amino-3,7-dihydro-2H-inden-1-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-(6-amino-3,7-dihydro-2H-inden-1-yl)ethyl]acetamide |
| PubChem CID | 70204797 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | N-[2-(6-amino-3,7-dihydro-2H-inden-1-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCC1=C2CC(N)=CC=C2CC1 |
| InChI | InChI=1S/C13H18N2O/c1-9(16)15-7-6-11-3-2-10-4-5-12(14)8-13(10)11/h4-5H,2-3,6-8,14H2,1H3,(H,15,16) |
| InChIKey | WMFNVLUPLNJLJQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(6-amino-3,7-dihydro-2H-inden-1-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(6-amino-3,7-dihydro-2H-inden-1-yl)ethyl]acetamide?
The IUPAC name of N-[2-(6-amino-3,7-dihydro-2H-inden-1-yl)ethyl]acetamide (CID 70204797) is N-[2-(6-amino-3,7-dihydro-2H-inden-1-yl)ethyl]acetamide.
What is the SMILES notation for N-[2-(6-amino-3,7-dihydro-2H-inden-1-yl)ethyl]acetamide?
The canonical SMILES for N-[2-(6-amino-3,7-dihydro-2H-inden-1-yl)ethyl]acetamide is CC(=O)NCCC1=C2CC(N)=CC=C2CC1.
What is the InChIKey of N-[2-(6-amino-3,7-dihydro-2H-inden-1-yl)ethyl]acetamide?
The InChIKey is WMFNVLUPLNJLJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O/c1-9(16)15-7-6-11-3-2-10-4-5-12(14)8-13(10)11/h4-5H,2-3,6-8,14H2,1H3,(H,15,16).
What are the key properties of N-[2-(6-amino-3,7-dihydro-2H-inden-1-yl)ethyl]acetamide?
N-[2-(6-amino-3,7-dihydro-2H-inden-1-yl)ethyl]acetamide has a molecular weight of 218.30 g/mol, XLogP of 1.78, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(6-amino-3,7-dihydro-2H-inden-1-yl)ethyl]acetamide is sourced from PubChem (CID 70204797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).