About (2R)-2-amino-1,1,3-triphenylpropan-1-ol
(2R)-2-amino-1,1,3-triphenylpropan-1-ol (PubChem CID 7020525) has the molecular formula C21H21NO
and a molecular weight of 303.41 g/mol. Its IUPAC name is (2R)-2-amino-1,1,3-triphenylpropan-1-ol.
Molecular Properties
| Compound Name | (2R)-2-amino-1,1,3-triphenylpropan-1-ol |
| PubChem CID | 7020525 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (2R)-2-amino-1,1,3-triphenylpropan-1-ol |
| SMILES | N[C@H](Cc1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21NO/c22-20(16-17-10-4-1-5-11-17)21(23,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20,23H,16,22H2/t20-/m1/s1 |
| InChIKey | KBXBDYRXZGBOIH-HXUWFJFHSA-N |
| XLogP | 3.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-amino-1,1,3-triphenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-1,1,3-triphenylpropan-1-ol?
The IUPAC name of (2R)-2-amino-1,1,3-triphenylpropan-1-ol (CID 7020525) is (2R)-2-amino-1,1,3-triphenylpropan-1-ol.
What is the SMILES notation for (2R)-2-amino-1,1,3-triphenylpropan-1-ol?
The canonical SMILES for (2R)-2-amino-1,1,3-triphenylpropan-1-ol is N[C@H](Cc1ccccc1)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of (2R)-2-amino-1,1,3-triphenylpropan-1-ol?
The InChIKey is KBXBDYRXZGBOIH-HXUWFJFHSA-N. The full InChI is InChI=1S/C21H21NO/c22-20(16-17-10-4-1-5-11-17)21(23,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20,23H,16,22H2/t20-/m1/s1.
What are the key properties of (2R)-2-amino-1,1,3-triphenylpropan-1-ol?
(2R)-2-amino-1,1,3-triphenylpropan-1-ol has a molecular weight of 303.41 g/mol, XLogP of 3.49, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-1,1,3-triphenylpropan-1-ol is sourced from PubChem (CID 7020525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).