About benzoic acid;2-phenylbenzamide
benzoic acid;2-phenylbenzamide (PubChem CID 70205361) has the molecular formula C20H17NO3
and a molecular weight of 319.36 g/mol. Its IUPAC name is benzoic acid;2-phenylbenzamide.
Molecular Properties
| Compound Name | benzoic acid;2-phenylbenzamide |
| PubChem CID | 70205361 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | benzoic acid;2-phenylbenzamide |
| SMILES | NC(=O)c1ccccc1-c1ccccc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C13H11NO.C7H6O2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10;8-7(9)6-4-2-1-3-5-6/h1-9H,(H2,14,15);1-5H,(H,8,9) |
| InChIKey | OJSZISCKZCEYEQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzoic acid;2-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;2-phenylbenzamide?
The IUPAC name of benzoic acid;2-phenylbenzamide (CID 70205361) is benzoic acid;2-phenylbenzamide.
What is the SMILES notation for benzoic acid;2-phenylbenzamide?
The canonical SMILES for benzoic acid;2-phenylbenzamide is NC(=O)c1ccccc1-c1ccccc1.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;2-phenylbenzamide?
The InChIKey is OJSZISCKZCEYEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO.C7H6O2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10;8-7(9)6-4-2-1-3-5-6/h1-9H,(H2,14,15);1-5H,(H,8,9).
What are the key properties of benzoic acid;2-phenylbenzamide?
benzoic acid;2-phenylbenzamide has a molecular weight of 319.36 g/mol, XLogP of 3.84, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;2-phenylbenzamide is sourced from PubChem (CID 70205361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).