C13H20N2 — CID 70205476
2-piperidin-1-yl-2,3,3a,7a-tetrahydro-1H-indole (PubChem CID 70205476) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 2-piperidin-1-yl-2,3,3a,7a-tetrahydro-1H-indole.
| Compound Name | 2-piperidin-1-yl-2,3,3a,7a-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 70205476 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 2-piperidin-1-yl-2,3,3a,7a-tetrahydro-1H-indole |
| SMILES | C1=CC2CC(N3CCCCC3)NC2C=C1 |
| InChI | InChI=1S/C13H20N2/c1-4-8-15(9-5-1)13-10-11-6-2-3-7-12(11)14-13/h2-3,6-7,11-14H,1,4-5,8-10H2 |
| InChIKey | ZAKMQVVZDHREFA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |