About 2-cyclohexylbenzoic acid
2-cyclohexylbenzoic acid (PubChem CID 7020572) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-cyclohexylbenzoic acid.
Molecular Properties
| Compound Name | 2-cyclohexylbenzoic acid |
| PubChem CID | 7020572 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2-cyclohexylbenzoic acid |
| SMILES | O=C(O)c1ccccc1C1CCCCC1 |
| InChI | InChI=1S/C13H16O2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2,(H,14,15) |
| InChIKey | ZKTFZNPTAJIXMK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclohexylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylbenzoic acid?
The IUPAC name of 2-cyclohexylbenzoic acid (CID 7020572) is 2-cyclohexylbenzoic acid.
What is the SMILES notation for 2-cyclohexylbenzoic acid?
The canonical SMILES for 2-cyclohexylbenzoic acid is O=C(O)c1ccccc1C1CCCCC1.
What is the InChIKey of 2-cyclohexylbenzoic acid?
The InChIKey is ZKTFZNPTAJIXMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2,(H,14,15).
What are the key properties of 2-cyclohexylbenzoic acid?
2-cyclohexylbenzoic acid has a molecular weight of 204.27 g/mol, XLogP of 3.43, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylbenzoic acid is sourced from PubChem (CID 7020572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).