C8H15N3O2S2 — CID 7020575
(2S)-4-methylsulfanyl-2-(4-sulfanylidene-1,3,5-triazinan-1-ium-1-yl)butanoate (PubChem CID 7020575) has the molecular formula C8H15N3O2S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-(4-sulfanylidene-1,3,5-triazinan-1-ium-1-yl)butanoate.
| Compound Name | (2S)-4-methylsulfanyl-2-(4-sulfanylidene-1,3,5-triazinan-1-ium-1-yl)butanoate |
|---|---|
| PubChem CID | 7020575 |
| Molecular Formula | C8H15N3O2S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-(4-sulfanylidene-1,3,5-triazinan-1-ium-1-yl)butanoate |
| SMILES | CSCCC(C(=O)[O-])[NH+]1CNC(=S)NC1 |
| InChI | InChI=1S/C8H15N3O2S2/c1-15-3-2-6(7(12)13)11-4-9-8(14)10-5-11/h6H,2-5H2,1H3,(H,12,13)(H2,9,10,14) |
| InChIKey | VCKZIPWRLLVXDN-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|