About 4,5-dihydro-1,3-oxazole;ethyl carbamate
4,5-dihydro-1,3-oxazole;ethyl carbamate (PubChem CID 70205962) has the molecular formula C6H12N2O3
and a molecular weight of 160.17 g/mol. Its IUPAC name is 4,5-dihydro-1,3-oxazole;ethyl carbamate.
Molecular Properties
| Compound Name | 4,5-dihydro-1,3-oxazole;ethyl carbamate |
| PubChem CID | 70205962 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 4,5-dihydro-1,3-oxazole;ethyl carbamate |
| SMILES | C1=NCCO1.CCOC(N)=O |
| InChI | InChI=1S/C3H7NO2.C3H5NO/c1-2-6-3(4)5;1-2-5-3-4-1/h2H2,1H3,(H2,4,5);3H,1-2H2 |
| InChIKey | QWHCHFSBFBBSFT-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dihydro-1,3-oxazole;ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1,3-oxazole;ethyl carbamate?
The IUPAC name of 4,5-dihydro-1,3-oxazole;ethyl carbamate (CID 70205962) is 4,5-dihydro-1,3-oxazole;ethyl carbamate.
What is the SMILES notation for 4,5-dihydro-1,3-oxazole;ethyl carbamate?
The canonical SMILES for 4,5-dihydro-1,3-oxazole;ethyl carbamate is C1=NCCO1.CCOC(N)=O.
What is the InChIKey of 4,5-dihydro-1,3-oxazole;ethyl carbamate?
The InChIKey is QWHCHFSBFBBSFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.C3H5NO/c1-2-6-3(4)5;1-2-5-3-4-1/h2H2,1H3,(H2,4,5);3H,1-2H2.
What are the key properties of 4,5-dihydro-1,3-oxazole;ethyl carbamate?
4,5-dihydro-1,3-oxazole;ethyl carbamate has a molecular weight of 160.17 g/mol, XLogP of 0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1,3-oxazole;ethyl carbamate is sourced from PubChem (CID 70205962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).