C13H16IN — CID 70205982
7-iodo-2,3,5,6,7,11b-hexahydro-1H-pyrrolo[2,1-a][2]benzazepine (PubChem CID 70205982) has the molecular formula C13H16IN and a molecular weight of 313.18 g/mol. Its IUPAC name is 7-iodo-2,3,5,6,7,11b-hexahydro-1H-pyrrolo[2,1-a][2]benzazepine.
| Compound Name | 7-iodo-2,3,5,6,7,11b-hexahydro-1H-pyrrolo[2,1-a][2]benzazepine |
|---|---|
| PubChem CID | 70205982 |
| Molecular Formula | C13H16IN |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 7-iodo-2,3,5,6,7,11b-hexahydro-1H-pyrrolo[2,1-a][2]benzazepine |
| SMILES | IC1CCN2CCCC2c2ccccc21 |
| InChI | InChI=1S/C13H16IN/c14-12-7-9-15-8-3-6-13(15)11-5-2-1-4-10(11)12/h1-2,4-5,12-13H,3,6-9H2 |
| InChIKey | QIHRAOVWQZWZSM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|