C19H24ClN3O3 — CID 70206248
5-butylidene-3-(5-imidazo[1,2-a]pyridin-5-ylpentyl)-1,3-oxazolidine-2,4-dione;hydrochloride (PubChem CID 70206248) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is 5-butylidene-3-(5-imidazo[1,2-a]pyridin-5-ylpentyl)-1,3-oxazolidine-2,4-dione;hydrochloride.
| Compound Name | 5-butylidene-3-(5-imidazo[1,2-a]pyridin-5-ylpentyl)-1,3-oxazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 70206248 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 5-butylidene-3-(5-imidazo[1,2-a]pyridin-5-ylpentyl)-1,3-oxazolidine-2,4-dione;hydrochloride |
| SMILES | CCCC=C1OC(=O)N(CCCCCc2cccc3nccn23)C1=O.Cl |
| InChI | InChI=1S/C19H23N3O3.ClH/c1-2-3-10-16-18(23)22(19(24)25-16)13-6-4-5-8-15-9-7-11-17-20-12-14-21(15)17;/h7,9-12,14H,2-6,8,13H2,1H3;1H |
| InChIKey | CPAVHIKINOHRQC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|