About 3,6-bis(aminomethyl)benzene-1,2-dicarbonitrile
3,6-bis(aminomethyl)benzene-1,2-dicarbonitrile (PubChem CID 70206262) has the molecular formula C10H10N4
and a molecular weight of 186.22 g/mol. Its IUPAC name is 3,6-bis(aminomethyl)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 3,6-bis(aminomethyl)benzene-1,2-dicarbonitrile |
| PubChem CID | 70206262 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 3,6-bis(aminomethyl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(CN)ccc(CN)c1C#N |
| InChI | InChI=1S/C10H10N4/c11-3-7-1-2-8(4-12)10(6-14)9(7)5-13/h1-2H,3-4,11-12H2 |
| InChIKey | YTQDXROAWLOETR-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,6-bis(aminomethyl)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-bis(aminomethyl)benzene-1,2-dicarbonitrile?
The IUPAC name of 3,6-bis(aminomethyl)benzene-1,2-dicarbonitrile (CID 70206262) is 3,6-bis(aminomethyl)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 3,6-bis(aminomethyl)benzene-1,2-dicarbonitrile?
The canonical SMILES for 3,6-bis(aminomethyl)benzene-1,2-dicarbonitrile is N#Cc1c(CN)ccc(CN)c1C#N.
What is the InChIKey of 3,6-bis(aminomethyl)benzene-1,2-dicarbonitrile?
The InChIKey is YTQDXROAWLOETR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4/c11-3-7-1-2-8(4-12)10(6-14)9(7)5-13/h1-2H,3-4,11-12H2.
What are the key properties of 3,6-bis(aminomethyl)benzene-1,2-dicarbonitrile?
3,6-bis(aminomethyl)benzene-1,2-dicarbonitrile has a molecular weight of 186.22 g/mol, XLogP of 0.35, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-bis(aminomethyl)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 70206262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).