About 2-aminobenzamide;2-phenyl-2,3-dihydro-1H-quinazolin-4-one
2-aminobenzamide;2-phenyl-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 70206488) has the molecular formula C21H20N4O2
and a molecular weight of 360.42 g/mol. Its IUPAC name is 2-aminobenzamide;2-phenyl-2,3-dihydro-1H-quinazolin-4-one.
Molecular Properties
| Compound Name | 2-aminobenzamide;2-phenyl-2,3-dihydro-1H-quinazolin-4-one |
| PubChem CID | 70206488 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-aminobenzamide;2-phenyl-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | NC(=O)c1ccccc1N.O=C1NC(c2ccccc2)Nc2ccccc21 |
| InChI | InChI=1S/C14H12N2O.C7H8N2O/c17-14-11-8-4-5-9-12(11)15-13(16-14)10-6-2-1-3-7-10;8-6-4-2-1-3-5(6)7(9)10/h1-9,13,15H,(H,16,17);1-4H,8H2,(H2,9,10) |
| InChIKey | JONDGXORECJTBW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzamide;2-phenyl-2,3-dihydro-1H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzamide;2-phenyl-2,3-dihydro-1H-quinazolin-4-one?
The IUPAC name of 2-aminobenzamide;2-phenyl-2,3-dihydro-1H-quinazolin-4-one (CID 70206488) is 2-aminobenzamide;2-phenyl-2,3-dihydro-1H-quinazolin-4-one.
What is the SMILES notation for 2-aminobenzamide;2-phenyl-2,3-dihydro-1H-quinazolin-4-one?
The canonical SMILES for 2-aminobenzamide;2-phenyl-2,3-dihydro-1H-quinazolin-4-one is NC(=O)c1ccccc1N.O=C1NC(c2ccccc2)Nc2ccccc21.
What is the InChIKey of 2-aminobenzamide;2-phenyl-2,3-dihydro-1H-quinazolin-4-one?
The InChIKey is JONDGXORECJTBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O.C7H8N2O/c17-14-11-8-4-5-9-12(11)15-13(16-14)10-6-2-1-3-7-10;8-6-4-2-1-3-5(6)7(9)10/h1-9,13,15H,(H,16,17);1-4H,8H2,(H2,9,10).
What are the key properties of 2-aminobenzamide;2-phenyl-2,3-dihydro-1H-quinazolin-4-one?
2-aminobenzamide;2-phenyl-2,3-dihydro-1H-quinazolin-4-one has a molecular weight of 360.42 g/mol, XLogP of 2.91, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzamide;2-phenyl-2,3-dihydro-1H-quinazolin-4-one is sourced from PubChem (CID 70206488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).