About 2-O-tert-butyl 4-O-methyl (2S)-5-(1-acetamido-3-methylbutyl)oxolane-2,4-dicarboxylate
2-O-tert-butyl 4-O-methyl (2S)-5-(1-acetamido-3-methylbutyl)oxolane-2,4-dicarboxylate (PubChem CID 70206586) has the molecular formula C18H31NO6
and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-O-tert-butyl 4-O-methyl (2S)-5-(1-acetamido-3-methylbutyl)oxolane-2,4-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-tert-butyl 4-O-methyl (2S)-5-(1-acetamido-3-methylbutyl)oxolane-2,4-dicarboxylate |
| PubChem CID | 70206586 |
| Molecular Formula | C18H31NO6 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 2-O-tert-butyl 4-O-methyl (2S)-5-(1-acetamido-3-methylbutyl)oxolane-2,4-dicarboxylate |
| SMILES | COC(=O)C1C[C@@H](C(=O)OC(C)(C)C)OC1C(CC(C)C)NC(C)=O |
| InChI | InChI=1S/C18H31NO6/c1-10(2)8-13(19-11(3)20)15-12(16(21)23-7)9-14(24-15)17(22)25-18(4,5)6/h10,12-15H,8-9H2,1-7H3,(H,19,20)/t12?,13?,14-,15?/m0/s1 |
| InChIKey | VQVWMGVEWFWWQP-YFXXHVASSA-N |
| XLogP | 1.83 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-O-tert-butyl 4-O-methyl (2S)-5-(1-acetamido-3-methylbutyl)oxolane-2,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-tert-butyl 4-O-methyl (2S)-5-(1-acetamido-3-methylbutyl)oxolane-2,4-dicarboxylate?
The IUPAC name of 2-O-tert-butyl 4-O-methyl (2S)-5-(1-acetamido-3-methylbutyl)oxolane-2,4-dicarboxylate (CID 70206586) is 2-O-tert-butyl 4-O-methyl (2S)-5-(1-acetamido-3-methylbutyl)oxolane-2,4-dicarboxylate.
What is the SMILES notation for 2-O-tert-butyl 4-O-methyl (2S)-5-(1-acetamido-3-methylbutyl)oxolane-2,4-dicarboxylate?
The canonical SMILES for 2-O-tert-butyl 4-O-methyl (2S)-5-(1-acetamido-3-methylbutyl)oxolane-2,4-dicarboxylate is COC(=O)C1C[C@@H](C(=O)OC(C)(C)C)OC1C(CC(C)C)NC(C)=O.
What is the InChIKey of 2-O-tert-butyl 4-O-methyl (2S)-5-(1-acetamido-3-methylbutyl)oxolane-2,4-dicarboxylate?
The InChIKey is VQVWMGVEWFWWQP-YFXXHVASSA-N. The full InChI is InChI=1S/C18H31NO6/c1-10(2)8-13(19-11(3)20)15-12(16(21)23-7)9-14(24-15)17(22)25-18(4,5)6/h10,12-15H,8-9H2,1-7H3,(H,19,20)/t12?,13?,14-,15?/m0/s1.
What are the key properties of 2-O-tert-butyl 4-O-methyl (2S)-5-(1-acetamido-3-methylbutyl)oxolane-2,4-dicarboxylate?
2-O-tert-butyl 4-O-methyl (2S)-5-(1-acetamido-3-methylbutyl)oxolane-2,4-dicarboxylate has a molecular weight of 357.45 g/mol, XLogP of 1.83, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-tert-butyl 4-O-methyl (2S)-5-(1-acetamido-3-methylbutyl)oxolane-2,4-dicarboxylate is sourced from PubChem (CID 70206586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).