About 6-hydroxy-2,3-dihydroinden-1-one
6-hydroxy-2,3-dihydroinden-1-one (PubChem CID 7020659) has the molecular formula C9H8O2
and a molecular weight of 148.16 g/mol. Its IUPAC name is 6-hydroxy-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 6-hydroxy-2,3-dihydroinden-1-one |
| PubChem CID | 7020659 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 6-hydroxy-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2ccc(O)cc21 |
| InChI | InChI=1S/C9H8O2/c10-7-3-1-6-2-4-9(11)8(6)5-7/h1,3,5,10H,2,4H2 |
| InChIKey | MOANRQDXNNXOLW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-hydroxy-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2,3-dihydroinden-1-one?
The IUPAC name of 6-hydroxy-2,3-dihydroinden-1-one (CID 7020659) is 6-hydroxy-2,3-dihydroinden-1-one.
What is the SMILES notation for 6-hydroxy-2,3-dihydroinden-1-one?
The canonical SMILES for 6-hydroxy-2,3-dihydroinden-1-one is O=C1CCc2ccc(O)cc21.
What is the InChIKey of 6-hydroxy-2,3-dihydroinden-1-one?
The InChIKey is MOANRQDXNNXOLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2/c10-7-3-1-6-2-4-9(11)8(6)5-7/h1,3,5,10H,2,4H2.
What are the key properties of 6-hydroxy-2,3-dihydroinden-1-one?
6-hydroxy-2,3-dihydroinden-1-one has a molecular weight of 148.16 g/mol, XLogP of 1.52, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2,3-dihydroinden-1-one is sourced from PubChem (CID 7020659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).