C12H17NO — CID 70207323
3,5,5a,8,9,9a,10,10a-octahydropyrrolo[1,2-b]isoquinolin-10-ol (PubChem CID 70207323) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 3,5,5a,8,9,9a,10,10a-octahydropyrrolo[1,2-b]isoquinolin-10-ol.
| Compound Name | 3,5,5a,8,9,9a,10,10a-octahydropyrrolo[1,2-b]isoquinolin-10-ol |
|---|---|
| PubChem CID | 70207323 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 3,5,5a,8,9,9a,10,10a-octahydropyrrolo[1,2-b]isoquinolin-10-ol |
| SMILES | OC1C2CCC=CC2CN2CC=CC12 |
| InChI | InChI=1S/C12H17NO/c14-12-10-5-2-1-4-9(10)8-13-7-3-6-11(12)13/h1,3-4,6,9-12,14H,2,5,7-8H2 |
| InChIKey | WGGFSSKIQWAEMO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|