C7H13Cl2NO — CID 70207780
3,5-dichloro-4-propan-2-ylmorpholine (PubChem CID 70207780) has the molecular formula C7H13Cl2NO and a molecular weight of 198.09 g/mol. Its IUPAC name is 3,5-dichloro-4-propan-2-ylmorpholine.
| Compound Name | 3,5-dichloro-4-propan-2-ylmorpholine |
|---|---|
| PubChem CID | 70207780 |
| Molecular Formula | C7H13Cl2NO |
| Molecular Weight | 198.09 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 3,5-dichloro-4-propan-2-ylmorpholine |
| SMILES | CC(C)N1C(Cl)COCC1Cl |
| InChI | InChI=1S/C7H13Cl2NO/c1-5(2)10-6(8)3-11-4-7(10)9/h5-7H,3-4H2,1-2H3 |
| InChIKey | RTWSHOUZVJJBBY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.09 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|