About 2,3-dimethyl-4-oxothieno[3,2-c]pyridine-5-carboxamide
2,3-dimethyl-4-oxothieno[3,2-c]pyridine-5-carboxamide (PubChem CID 70207783) has the molecular formula C10H10N2O2S
and a molecular weight of 222.27 g/mol. Its IUPAC name is 2,3-dimethyl-4-oxothieno[3,2-c]pyridine-5-carboxamide.
Molecular Properties
| Compound Name | 2,3-dimethyl-4-oxothieno[3,2-c]pyridine-5-carboxamide |
| PubChem CID | 70207783 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 2,3-dimethyl-4-oxothieno[3,2-c]pyridine-5-carboxamide |
| SMILES | Cc1sc2ccn(C(N)=O)c(=O)c2c1C |
| InChI | InChI=1S/C10H10N2O2S/c1-5-6(2)15-7-3-4-12(10(11)14)9(13)8(5)7/h3-4H,1-2H3,(H2,11,14) |
| InChIKey | XTLVDUMPHJUAIE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dimethyl-4-oxothieno[3,2-c]pyridine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4-oxothieno[3,2-c]pyridine-5-carboxamide?
The IUPAC name of 2,3-dimethyl-4-oxothieno[3,2-c]pyridine-5-carboxamide (CID 70207783) is 2,3-dimethyl-4-oxothieno[3,2-c]pyridine-5-carboxamide.
What is the SMILES notation for 2,3-dimethyl-4-oxothieno[3,2-c]pyridine-5-carboxamide?
The canonical SMILES for 2,3-dimethyl-4-oxothieno[3,2-c]pyridine-5-carboxamide is Cc1sc2ccn(C(N)=O)c(=O)c2c1C.
What is the InChIKey of 2,3-dimethyl-4-oxothieno[3,2-c]pyridine-5-carboxamide?
The InChIKey is XTLVDUMPHJUAIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2S/c1-5-6(2)15-7-3-4-12(10(11)14)9(13)8(5)7/h3-4H,1-2H3,(H2,11,14).
What are the key properties of 2,3-dimethyl-4-oxothieno[3,2-c]pyridine-5-carboxamide?
2,3-dimethyl-4-oxothieno[3,2-c]pyridine-5-carboxamide has a molecular weight of 222.27 g/mol, XLogP of 1.61, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4-oxothieno[3,2-c]pyridine-5-carboxamide is sourced from PubChem (CID 70207783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).