About 2-[4-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexyl]piperazin-1-yl]quinoline
2-[4-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexyl]piperazin-1-yl]quinoline (PubChem CID 70208063) has the molecular formula C26H29N5
and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-[4-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexyl]piperazin-1-yl]quinoline.
Molecular Properties
| Compound Name | 2-[4-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexyl]piperazin-1-yl]quinoline |
| PubChem CID | 70208063 |
| Molecular Formula | C26H29N5 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 2-[4-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexyl]piperazin-1-yl]quinoline |
| SMILES | c1ccc2nc(N3CCN(C4CCC(c5c[nH]c6ncccc56)CC4)CC3)ccc2c1 |
| InChI | InChI=1S/C26H29N5/c1-2-6-24-20(4-1)9-12-25(29-24)31-16-14-30(15-17-31)21-10-7-19(8-11-21)23-18-28-26-22(23)5-3-13-27-26/h1-6,9,12-13,18-19,21H,7-8,10-11,14-17H2,(H,27,28) |
| InChIKey | ROXFPYRHGGJCCL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexyl]piperazin-1-yl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexyl]piperazin-1-yl]quinoline?
The IUPAC name of 2-[4-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexyl]piperazin-1-yl]quinoline (CID 70208063) is 2-[4-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexyl]piperazin-1-yl]quinoline.
What is the SMILES notation for 2-[4-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexyl]piperazin-1-yl]quinoline?
The canonical SMILES for 2-[4-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexyl]piperazin-1-yl]quinoline is c1ccc2nc(N3CCN(C4CCC(c5c[nH]c6ncccc56)CC4)CC3)ccc2c1.
What is the InChIKey of 2-[4-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexyl]piperazin-1-yl]quinoline?
The InChIKey is ROXFPYRHGGJCCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29N5/c1-2-6-24-20(4-1)9-12-25(29-24)31-16-14-30(15-17-31)21-10-7-19(8-11-21)23-18-28-26-22(23)5-3-13-27-26/h1-6,9,12-13,18-19,21H,7-8,10-11,14-17H2,(H,27,28).
What are the key properties of 2-[4-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexyl]piperazin-1-yl]quinoline?
2-[4-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexyl]piperazin-1-yl]quinoline has a molecular weight of 411.55 g/mol, XLogP of 4.96, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-(1H-pyrrolo[2,3-b]pyridin-3-yl)cyclohexyl]piperazin-1-yl]quinoline is sourced from PubChem (CID 70208063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).