C40H38FN9O6 — CID 70208190
ethyl 4-(4-fluorophenyl)-2-(2-pyridin-2-ylethylamino)pyrimidine-5-carboxylate;ethyl 4-(3-nitrophenyl)-2-(2-pyridin-2-ylethylamino)pyrimidine-5-carboxylate (PubChem CID 70208190) has the molecular formula C40H38FN9O6 and a molecular weight of 759.80 g/mol. Its IUPAC name is ethyl 4-(4-fluorophenyl)-2-(2-pyridin-2-ylethylamino)pyrimidine-5-carboxylate;ethyl 4-(3-nitrophenyl)-2-(2-pyridin-2-ylethylamino)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(4-fluorophenyl)-2-(2-pyridin-2-ylethylamino)pyrimidine-5-carboxylate;ethyl 4-(3-nitrophenyl)-2-(2-pyridin-2-ylethylamino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 70208190 |
| Molecular Formula | C40H38FN9O6 |
| Molecular Weight | 759.80 g/mol |
| Exact Mass | 759.29 |
| IUPAC Name | ethyl 4-(4-fluorophenyl)-2-(2-pyridin-2-ylethylamino)pyrimidine-5-carboxylate;ethyl 4-(3-nitrophenyl)-2-(2-pyridin-2-ylethylamino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCCc2ccccn2)nc1-c1ccc(F)cc1.CCOC(=O)c1cnc(NCCc2ccccn2)nc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19FN4O2.C20H19N5O4/c1-2-27-19(26)17-13-24-20(23-12-10-16-5-3-4-11-22-16)25-18(17)14-6-8-15(21)9-7-14;1-2-29-19(26)17-13-23-20(22-11-9-15-7-3-4-10-21-15)24-18(17)14-6-5-8-16(12-14)25(27)28/h3-9,11,13H,2,10,12H2,1H3,(H,23,24,25);3-8,10,12-13H,2,9,11H2,1H3,(H,22,23,24) |
| InChIKey | OKLQVYQXRZJVLW-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 197.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.80 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|