C22H19F3N2O3 — CID 70208217
6-[(E)-2-[3-(hydroxymethyl)phenyl]ethenyl]naphthalene-2-carboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 70208217) has the molecular formula C22H19F3N2O3 and a molecular weight of 416.40 g/mol. Its IUPAC name is 6-[(E)-2-[3-(hydroxymethyl)phenyl]ethenyl]naphthalene-2-carboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[(E)-2-[3-(hydroxymethyl)phenyl]ethenyl]naphthalene-2-carboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70208217 |
| Molecular Formula | C22H19F3N2O3 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 6-[(E)-2-[3-(hydroxymethyl)phenyl]ethenyl]naphthalene-2-carboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc2cc(/C=C/c3cccc(CO)c3)ccc2c1 |
| InChI | InChI=1S/C20H18N2O.C2HF3O2/c21-20(22)19-9-8-17-11-15(6-7-18(17)12-19)5-4-14-2-1-3-16(10-14)13-23;3-2(4,5)1(6)7/h1-12,23H,13H2,(H3,21,22);(H,6,7)/b5-4+; |
| InChIKey | OLFSJEUQPANDIQ-FXRZFVDSSA-N |
| XLogP | 4.42 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|