C32H45ClO5 — CID 70208235
[(1S,3S,12S,14S,15R)-15-[(2S)-1-[3-(chloromethyl)-4-methyloxolan-2-yl]-1-oxopropan-2-yl]-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate (PubChem CID 70208235) has the molecular formula C32H45ClO5 and a molecular weight of 545.16 g/mol. Its IUPAC name is [(1S,3S,12S,14S,15R)-15-[(2S)-1-[3-(chloromethyl)-4-methyloxolan-2-yl]-1-oxopropan-2-yl]-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate.
| Compound Name | [(1S,3S,12S,14S,15R)-15-[(2S)-1-[3-(chloromethyl)-4-methyloxolan-2-yl]-1-oxopropan-2-yl]-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate |
|---|---|
| PubChem CID | 70208235 |
| Molecular Formula | C32H45ClO5 |
| Molecular Weight | 545.16 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | [(1S,3S,12S,14S,15R)-15-[(2S)-1-[3-(chloromethyl)-4-methyloxolan-2-yl]-1-oxopropan-2-yl]-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@]2(C)C3CCC4C(C)C(=O)C=C[C@@]45C[C@@]35CCC2(C)[C@H]1[C@H](C)C(=O)C1OCC(C)C1CCl |
| InChI | InChI=1S/C32H45ClO5/c1-17-15-37-28(21(17)14-33)27(36)19(3)26-24(38-20(4)34)13-30(6)25-8-7-22-18(2)23(35)9-10-31(22)16-32(25,31)12-11-29(26,30)5/h9-10,17-19,21-22,24-26,28H,7-8,11-16H2,1-6H3/t17?,18?,19-,21?,22?,24-,25?,26-,28?,29?,30-,31+,32-/m0/s1 |
| InChIKey | HGEYODIZJSCYBR-ZZUMAKMZSA-N |
| XLogP | 6.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.16 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|