C11H16O2 — CID 70208330
3,3a,4,5,6,7,8,9a-octahydro-2H-furo[2,3-b]chromene (PubChem CID 70208330) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 3,3a,4,5,6,7,8,9a-octahydro-2H-furo[2,3-b]chromene.
| Compound Name | 3,3a,4,5,6,7,8,9a-octahydro-2H-furo[2,3-b]chromene |
|---|---|
| PubChem CID | 70208330 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 3,3a,4,5,6,7,8,9a-octahydro-2H-furo[2,3-b]chromene |
| SMILES | C1CCC2=C(C1)CC1CCOC1O2 |
| InChI | InChI=1S/C11H16O2/c1-2-4-10-8(3-1)7-9-5-6-12-11(9)13-10/h9,11H,1-7H2 |
| InChIKey | ZRWPPMQXXSOXKF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |