About 2-(1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl)phenol
2-(1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl)phenol (PubChem CID 70208336) has the molecular formula C18H16O2
and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-(1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl)phenol.
Molecular Properties
| Compound Name | 2-(1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl)phenol |
| PubChem CID | 70208336 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-(1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl)phenol |
| SMILES | Oc1ccccc1C1(O)CC=CC=C1c1ccccc1 |
| InChI | InChI=1S/C18H16O2/c19-17-12-5-4-11-16(17)18(20)13-7-6-10-15(18)14-8-2-1-3-9-14/h1-12,19-20H,13H2 |
| InChIKey | MUEDBVLEFQNCHW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl)phenol?
The IUPAC name of 2-(1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl)phenol (CID 70208336) is 2-(1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl)phenol.
What is the SMILES notation for 2-(1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl)phenol?
The canonical SMILES for 2-(1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl)phenol is Oc1ccccc1C1(O)CC=CC=C1c1ccccc1.
What is the InChIKey of 2-(1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl)phenol?
The InChIKey is MUEDBVLEFQNCHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O2/c19-17-12-5-4-11-16(17)18(20)13-7-6-10-15(18)14-8-2-1-3-9-14/h1-12,19-20H,13H2.
What are the key properties of 2-(1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl)phenol?
2-(1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl)phenol has a molecular weight of 264.32 g/mol, XLogP of 3.62, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxy-2-phenylcyclohexa-2,4-dien-1-yl)phenol is sourced from PubChem (CID 70208336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).