C9H13Cl2FeN — CID 70208481
iron(2+);2,4,6-trimethylcyclohexa-2,4-dien-1-imine;dichloride (PubChem CID 70208481) has the molecular formula C9H13Cl2FeN and a molecular weight of 261.96 g/mol. Its IUPAC name is iron(2+);2,4,6-trimethylcyclohexa-2,4-dien-1-imine;dichloride.
| Compound Name | iron(2+);2,4,6-trimethylcyclohexa-2,4-dien-1-imine;dichloride |
|---|---|
| PubChem CID | 70208481 |
| Molecular Formula | C9H13Cl2FeN |
| Molecular Weight | 261.96 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | iron(2+);2,4,6-trimethylcyclohexa-2,4-dien-1-imine;dichloride |
| SMILES | [Cl-].[Cl-].[Fe+2].[H]/N=C1/C(C)=CC(C)=CC1C |
| InChI | InChI=1S/C9H13N.2ClH.Fe/c1-6-4-7(2)9(10)8(3)5-6;;;/h4-5,7,10H,1-3H3;2*1H;/q;;;+2/p-2/b10-9+;;; |
| InChIKey | UPGJFKNQAQWVAW-WCVSPGPUSA-L |
| XLogP | -3.45 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.96 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|