About 1-cyclohexyl-6,7-dimethoxyisoquinoline
1-cyclohexyl-6,7-dimethoxyisoquinoline (PubChem CID 70208603) has the molecular formula C17H21NO2
and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-cyclohexyl-6,7-dimethoxyisoquinoline.
Molecular Properties
| Compound Name | 1-cyclohexyl-6,7-dimethoxyisoquinoline |
| PubChem CID | 70208603 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-cyclohexyl-6,7-dimethoxyisoquinoline |
| SMILES | COc1cc2ccnc(C3CCCCC3)c2cc1OC |
| InChI | InChI=1S/C17H21NO2/c1-19-15-10-13-8-9-18-17(12-6-4-3-5-7-12)14(13)11-16(15)20-2/h8-12H,3-7H2,1-2H3 |
| InChIKey | AMFLTBXVXVGLQM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexyl-6,7-dimethoxyisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-6,7-dimethoxyisoquinoline?
The IUPAC name of 1-cyclohexyl-6,7-dimethoxyisoquinoline (CID 70208603) is 1-cyclohexyl-6,7-dimethoxyisoquinoline.
What is the SMILES notation for 1-cyclohexyl-6,7-dimethoxyisoquinoline?
The canonical SMILES for 1-cyclohexyl-6,7-dimethoxyisoquinoline is COc1cc2ccnc(C3CCCCC3)c2cc1OC.
What is the InChIKey of 1-cyclohexyl-6,7-dimethoxyisoquinoline?
The InChIKey is AMFLTBXVXVGLQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO2/c1-19-15-10-13-8-9-18-17(12-6-4-3-5-7-12)14(13)11-16(15)20-2/h8-12H,3-7H2,1-2H3.
What are the key properties of 1-cyclohexyl-6,7-dimethoxyisoquinoline?
1-cyclohexyl-6,7-dimethoxyisoquinoline has a molecular weight of 271.36 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-6,7-dimethoxyisoquinoline is sourced from PubChem (CID 70208603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).