About 2-(4,8-dioxothieno[3,2-f][1]benzothiol-2-yl)ethyl acetate
2-(4,8-dioxothieno[3,2-f][1]benzothiol-2-yl)ethyl acetate (PubChem CID 70208757) has the molecular formula C14H10O4S2
and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-(4,8-dioxothieno[3,2-f][1]benzothiol-2-yl)ethyl acetate.
Molecular Properties
| Compound Name | 2-(4,8-dioxothieno[3,2-f][1]benzothiol-2-yl)ethyl acetate |
| PubChem CID | 70208757 |
| Molecular Formula | C14H10O4S2 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 2-(4,8-dioxothieno[3,2-f][1]benzothiol-2-yl)ethyl acetate |
| SMILES | CC(=O)OCCc1cc2c(s1)C(=O)c1sccc1C2=O |
| InChI | InChI=1S/C14H10O4S2/c1-7(15)18-4-2-8-6-10-11(16)9-3-5-19-13(9)12(17)14(10)20-8/h3,5-6H,2,4H2,1H3 |
| InChIKey | AAIBDMBZSDHDQY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,8-dioxothieno[3,2-f][1]benzothiol-2-yl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,8-dioxothieno[3,2-f][1]benzothiol-2-yl)ethyl acetate?
The IUPAC name of 2-(4,8-dioxothieno[3,2-f][1]benzothiol-2-yl)ethyl acetate (CID 70208757) is 2-(4,8-dioxothieno[3,2-f][1]benzothiol-2-yl)ethyl acetate.
What is the SMILES notation for 2-(4,8-dioxothieno[3,2-f][1]benzothiol-2-yl)ethyl acetate?
The canonical SMILES for 2-(4,8-dioxothieno[3,2-f][1]benzothiol-2-yl)ethyl acetate is CC(=O)OCCc1cc2c(s1)C(=O)c1sccc1C2=O.
What is the InChIKey of 2-(4,8-dioxothieno[3,2-f][1]benzothiol-2-yl)ethyl acetate?
The InChIKey is AAIBDMBZSDHDQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O4S2/c1-7(15)18-4-2-8-6-10-11(16)9-3-5-19-13(9)12(17)14(10)20-8/h3,5-6H,2,4H2,1H3.
What are the key properties of 2-(4,8-dioxothieno[3,2-f][1]benzothiol-2-yl)ethyl acetate?
2-(4,8-dioxothieno[3,2-f][1]benzothiol-2-yl)ethyl acetate has a molecular weight of 306.36 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,8-dioxothieno[3,2-f][1]benzothiol-2-yl)ethyl acetate is sourced from PubChem (CID 70208757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).