C34H38N4O6S — CID 70208781
2-[[2-[4-[5-[4-[(E)-3-(hexylamino)-3-oxoprop-1-enyl]phenyl]-2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]phenoxy]acetyl]amino]-3-hydroxybutanoic acid (PubChem CID 70208781) has the molecular formula C34H38N4O6S and a molecular weight of 630.77 g/mol. Its IUPAC name is 2-[[2-[4-[5-[4-[(E)-3-(hexylamino)-3-oxoprop-1-enyl]phenyl]-2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]phenoxy]acetyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[4-[5-[4-[(E)-3-(hexylamino)-3-oxoprop-1-enyl]phenyl]-2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]phenoxy]acetyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 70208781 |
| Molecular Formula | C34H38N4O6S |
| Molecular Weight | 630.77 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | 2-[[2-[4-[5-[4-[(E)-3-(hexylamino)-3-oxoprop-1-enyl]phenyl]-2-(1H-pyrrol-2-yl)-1,3-thiazol-4-yl]phenoxy]acetyl]amino]-3-hydroxybutanoic acid |
| SMILES | CCCCCCNC(=O)/C=C/c1ccc(-c2sc(-c3ccc[nH]3)nc2-c2ccc(OCC(=O)NC(C(=O)O)C(C)O)cc2)cc1 |
| InChI | InChI=1S/C34H38N4O6S/c1-3-4-5-6-19-36-28(40)18-11-23-9-12-25(13-10-23)32-31(38-33(45-32)27-8-7-20-35-27)24-14-16-26(17-15-24)44-21-29(41)37-30(22(2)39)34(42)43/h7-18,20,22,30,35,39H,3-6,19,21H2,1-2H3,(H,36,40)(H,37,41)(H,42,43)/b18-11+ |
| InChIKey | HZSUMDAXIXMNJK-WOJGMQOQSA-N |
| XLogP | 5.51 |
| TPSA | 153.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.77 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|