About methyl 2-(2,4-difluorophenyl)-4-[3-(1H-imidazol-2-yl)prop-1-enyl]benzoate
methyl 2-(2,4-difluorophenyl)-4-[3-(1H-imidazol-2-yl)prop-1-enyl]benzoate (PubChem CID 70209238) has the molecular formula C20H16F2N2O2
and a molecular weight of 354.36 g/mol. Its IUPAC name is methyl 2-(2,4-difluorophenyl)-4-[3-(1H-imidazol-2-yl)prop-1-enyl]benzoate.
Molecular Properties
| Compound Name | methyl 2-(2,4-difluorophenyl)-4-[3-(1H-imidazol-2-yl)prop-1-enyl]benzoate |
| PubChem CID | 70209238 |
| Molecular Formula | C20H16F2N2O2 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | methyl 2-(2,4-difluorophenyl)-4-[3-(1H-imidazol-2-yl)prop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(C=CCc2ncc[nH]2)cc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C20H16F2N2O2/c1-26-20(25)16-7-5-13(3-2-4-19-23-9-10-24-19)11-17(16)15-8-6-14(21)12-18(15)22/h2-3,5-12H,4H2,1H3,(H,23,24) |
| InChIKey | WOVOURKTMLCOLF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(2,4-difluorophenyl)-4-[3-(1H-imidazol-2-yl)prop-1-enyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2,4-difluorophenyl)-4-[3-(1H-imidazol-2-yl)prop-1-enyl]benzoate?
The IUPAC name of methyl 2-(2,4-difluorophenyl)-4-[3-(1H-imidazol-2-yl)prop-1-enyl]benzoate (CID 70209238) is methyl 2-(2,4-difluorophenyl)-4-[3-(1H-imidazol-2-yl)prop-1-enyl]benzoate.
What is the SMILES notation for methyl 2-(2,4-difluorophenyl)-4-[3-(1H-imidazol-2-yl)prop-1-enyl]benzoate?
The canonical SMILES for methyl 2-(2,4-difluorophenyl)-4-[3-(1H-imidazol-2-yl)prop-1-enyl]benzoate is COC(=O)c1ccc(C=CCc2ncc[nH]2)cc1-c1ccc(F)cc1F.
What is the InChIKey of methyl 2-(2,4-difluorophenyl)-4-[3-(1H-imidazol-2-yl)prop-1-enyl]benzoate?
The InChIKey is WOVOURKTMLCOLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F2N2O2/c1-26-20(25)16-7-5-13(3-2-4-19-23-9-10-24-19)11-17(16)15-8-6-14(21)12-18(15)22/h2-3,5-12H,4H2,1H3,(H,23,24).
What are the key properties of methyl 2-(2,4-difluorophenyl)-4-[3-(1H-imidazol-2-yl)prop-1-enyl]benzoate?
methyl 2-(2,4-difluorophenyl)-4-[3-(1H-imidazol-2-yl)prop-1-enyl]benzoate has a molecular weight of 354.36 g/mol, XLogP of 4.40, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,4-difluorophenyl)-4-[3-(1H-imidazol-2-yl)prop-1-enyl]benzoate is sourced from PubChem (CID 70209238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).