C30H37F3N2O4S — CID 70209244
N-(4,5-dimethyl-1,2-oxazol-3-yl)-2-[3-methyl-4-non-1-en-3-yl-2-(2,2,2-trifluoroethoxymethyl)phenyl]benzenesulfonamide (PubChem CID 70209244) has the molecular formula C30H37F3N2O4S and a molecular weight of 578.70 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,2-oxazol-3-yl)-2-[3-methyl-4-non-1-en-3-yl-2-(2,2,2-trifluoroethoxymethyl)phenyl]benzenesulfonamide.
| Compound Name | N-(4,5-dimethyl-1,2-oxazol-3-yl)-2-[3-methyl-4-non-1-en-3-yl-2-(2,2,2-trifluoroethoxymethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70209244 |
| Molecular Formula | C30H37F3N2O4S |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | N-(4,5-dimethyl-1,2-oxazol-3-yl)-2-[3-methyl-4-non-1-en-3-yl-2-(2,2,2-trifluoroethoxymethyl)phenyl]benzenesulfonamide |
| SMILES | C=CC(CCCCCC)c1ccc(-c2ccccc2S(=O)(=O)Nc2noc(C)c2C)c(COCC(F)(F)F)c1C |
| InChI | InChI=1S/C30H37F3N2O4S/c1-6-8-9-10-13-23(7-2)24-16-17-25(27(21(24)4)18-38-19-30(31,32)33)26-14-11-12-15-28(26)40(36,37)35-29-20(3)22(5)39-34-29/h7,11-12,14-17,23H,2,6,8-10,13,18-19H2,1,3-5H3,(H,34,35) |
| InChIKey | REGPDZKGPZGBSC-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|