About benzene;1,3-dimethyl-1,3-diazinan-2-one
benzene;1,3-dimethyl-1,3-diazinan-2-one (PubChem CID 70209375) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is benzene;1,3-dimethyl-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | benzene;1,3-dimethyl-1,3-diazinan-2-one |
| PubChem CID | 70209375 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | benzene;1,3-dimethyl-1,3-diazinan-2-one |
| SMILES | CN1CCCN(C)C1=O.c1ccccc1 |
| InChI | InChI=1S/C6H12N2O.C6H6/c1-7-4-3-5-8(2)6(7)9;1-2-4-6-5-3-1/h3-5H2,1-2H3;1-6H |
| InChIKey | MICCXSDOJXMKKH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;1,3-dimethyl-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1,3-dimethyl-1,3-diazinan-2-one?
The IUPAC name of benzene;1,3-dimethyl-1,3-diazinan-2-one (CID 70209375) is benzene;1,3-dimethyl-1,3-diazinan-2-one.
What is the SMILES notation for benzene;1,3-dimethyl-1,3-diazinan-2-one?
The canonical SMILES for benzene;1,3-dimethyl-1,3-diazinan-2-one is CN1CCCN(C)C1=O.c1ccccc1.
What is the InChIKey of benzene;1,3-dimethyl-1,3-diazinan-2-one?
The InChIKey is MICCXSDOJXMKKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C6H6/c1-7-4-3-5-8(2)6(7)9;1-2-4-6-5-3-1/h3-5H2,1-2H3;1-6H.
What are the key properties of benzene;1,3-dimethyl-1,3-diazinan-2-one?
benzene;1,3-dimethyl-1,3-diazinan-2-one has a molecular weight of 206.29 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1,3-dimethyl-1,3-diazinan-2-one is sourced from PubChem (CID 70209375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).