C26H45NO4Si2 — CID 70209968
(3S,4aR,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one (PubChem CID 70209968) has the molecular formula C26H45NO4Si2 and a molecular weight of 491.82 g/mol. Its IUPAC name is (3S,4aR,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one.
| Compound Name | (3S,4aR,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one |
|---|---|
| PubChem CID | 70209968 |
| Molecular Formula | C26H45NO4Si2 |
| Molecular Weight | 491.82 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | (3S,4aR,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc([C@@H]2C[C@@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)CN3C(=O)O2)cc1 |
| InChI | InChI=1S/C26H45NO4Si2/c1-25(2,3)32(7,8)29-18-19-11-13-20(14-12-19)23-16-21-15-22(17-27(21)24(28)30-23)31-33(9,10)26(4,5)6/h11-14,21-23H,15-18H2,1-10H3/t21-,22+,23-/m0/s1 |
| InChIKey | GISKWLAKJXVWHR-ZRBLBEILSA-N |
| XLogP | 7.25 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.82 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|